
CAS 133676-10-5
:Methyl 2-(4-hydroxy-3-methoxyphenyl)-4-quinolinecarboxylate
Description:
Methyl 2-(4-hydroxy-3-methoxyphenyl)-4-quinolinecarboxylate, identified by its CAS number 133676-10-5, is an organic compound characterized by its complex structure that includes a quinoline moiety and a methoxy-substituted phenol. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It is likely to be soluble in organic solvents due to its hydrophobic characteristics, while its hydroxyl and methoxy groups may impart some degree of polarity. The presence of the quinoline structure suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antitumor activities. Additionally, the compound may exhibit UV absorbance due to its conjugated system, making it of interest in photochemical studies. Overall, Methyl 2-(4-hydroxy-3-methoxyphenyl)-4-quinolinecarboxylate represents a compound of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C18H15NO4
InChI:InChI=1S/C18H15NO4/c1-22-17-9-11(7-8-16(17)20)15-10-13(18(21)23-2)12-5-3-4-6-14(12)19-15/h3-10,20H,1-2H3
InChI key:InChIKey=QCBSPDBBULDMAN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=C(O)C=C3)C=CC=C2
Synonyms:- 4-Quinolinecarboxylic acid, 2-(4-hydroxy-3-methoxyphenyl)-, methyl ester
- Methyl 2-(4-hydroxy-3-methoxyphenyl)-4-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.