CAS 133681-72-8

N-(4-Methyl-3-nitrophenyl)formamide

Description:

N-(4-Methyl-3-nitrophenyl)formamide, with the CAS number 133681-72-8, is an organic compound characterized by its functional groups, including an amide and a nitro group. This compound features a phenyl ring substituted with a methyl group and a nitro group at specific positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the formamide group. The nitro group imparts potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the compound may display specific optical and electronic properties due to its aromatic structure and substituents. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling and storage conditions are essential. Overall, N-(4-Methyl-3-nitrophenyl)formamide is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.

Formula: C₈H₈N₂O₃

InChI: InChI=1S/C8H8N2O3/c1-6-2-3-7(9-5-11)4-8(6)10(12)13/h2-5H,1H3,(H,9,11)

InChI key: InChIKey=KYAAJMLFXXWUHD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC(NC=O)=CC=C1C

Synonyms:

• N-(4-Methyl-3-nitrophenyl)formamide
• Formamide, N-(4-methyl-3-nitrophenyl)-