CAS 13370-48-4
:2-(4-Chloro-2,5-dimethylphenoxy)acetic acid
Description:
2-(4-Chloro-2,5-dimethylphenoxy)acetic acid, commonly known as a herbicide, is characterized by its structural features that include a chloro-substituted aromatic ring and an acetic acid functional group. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, with limited solubility in water. It exhibits herbicidal properties, particularly effective against a range of broadleaf weeds while being less harmful to grasses, making it valuable in agricultural applications. The presence of the chloro and dimethyl groups enhances its biological activity and selectivity. Additionally, it is important to handle this substance with care due to its potential environmental impact and toxicity to non-target organisms. Its mode of action generally involves disrupting plant growth processes, leading to the inhibition of cell division and elongation. As with many chemical substances, proper safety measures should be observed when handling or applying this compound to mitigate risks to human health and the environment.
Formula:C10H11ClO3
InChI:InChI=1S/C10H11ClO3/c1-6-4-9(14-5-10(12)13)7(2)3-8(6)11/h3-4H,5H2,1-2H3,(H,12,13)
InChI key:InChIKey=FYSOXVMOZFIWIU-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(C)C=C(Cl)C(C)=C1
Synonyms:- Acetic acid, (4-chloro-2,5-dimethylphenoxy)-
- Acetic acid, [(4-chloro-2,5-xylyl)oxy]-
- 2-(4-Chloro-2,5-dimethylphenoxy)acetic acid
- (4-Chloro-2,5-dimethylphenoxy)acetic acid
- Acetic acid, 2-(4-chloro-2,5-dimethylphenoxy)-
- 4-Chloro-2,5-dimethylphenoxyacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.