
CAS 133708-29-9
:6-Fluoro-2H-1-benzopyran-3-carbonitrile
Description:
6-Fluoro-2H-1-benzopyran-3-carbonitrile is a chemical compound characterized by its unique structural features, which include a benzopyran ring system and a cyano group. The presence of the fluorine atom at the 6-position of the benzopyran enhances its reactivity and may influence its biological activity. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential interactions with biological targets due to its functional groups. The cyano group contributes to its polarity and can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, compounds of this class may exhibit interesting pharmacological properties, which can be explored in medicinal chemistry. Its CAS number, 133708-29-9, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 6-Fluoro-2H-1-benzopyran-3-carbonitrile is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H6FNO
InChI:InChI=1S/C10H6FNO/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-4H,6H2
InChI key:InChIKey=GBDNHRQBJXTNCR-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=2C(OC1)=CC=C(F)C2
Synonyms:- 6-Fluoro-2H-chromene-3-carbonitrile
- 2H-1-Benzopyran-3-carbonitrile, 6-fluoro-
- 6-Fluoro-2H-1-benzopyran-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.