
CAS 133708-30-2
:2H-1-Benzopyran-3-methanamine, 6-fluoro-3,4-dihydro-, hydrochloride (1:1)
Description:
2H-1-Benzopyran-3-methanamine, 6-fluoro-3,4-dihydro-, hydrochloride (1:1), with the CAS number 133708-30-2, is a chemical compound characterized by its benzopyran structure, which features a fused benzene and pyran ring. The presence of a methanamine group indicates that it contains an amine functional group, which can participate in various chemical reactions, including hydrogen bonding and nucleophilic substitution. The "6-fluoro" designation suggests that a fluorine atom is substituted at the sixth position of the benzopyran ring, potentially influencing the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied or utilized.
Formula:C10H12FNO·ClH
InChI:InChI=1S/C10H12FNO.ClH/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10;/h1-2,4,7H,3,5-6,12H2;1H
InChI key:InChIKey=DWHPLBHINFXWQZ-UHFFFAOYSA-N
SMILES:C(N)C1CC=2C(OC1)=CC=C(F)C2.Cl
Synonyms:- 2H-1-Benzopyran-3-methanamine, 6-fluoro-3,4-dihydro-, hydrochloride
- 2H-1-Benzopyran-3-methanamine, 6-fluoro-3,4-dihydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.