CAS 13371-17-0: Phosphonium, butyltriphenyl-, chloride (1:1)
Description:Phosphonium, butyltriphenyl-, chloride (1:1), commonly referred to as butyltriphenylphosphonium chloride, is a quaternary ammonium salt characterized by its phosphonium cation and chloride anion. The structure consists of a central phosphorus atom bonded to three phenyl groups and one butyl group, resulting in a bulky and lipophilic cation. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but less soluble in water due to its hydrophobic nature. It is often used in organic synthesis as a phase transfer catalyst, facilitating the transfer of ions between aqueous and organic phases. Additionally, butyltriphenylphosphonium chloride can serve as a reagent in various chemical reactions, including those involving nucleophilic substitutions. Safety data indicates that, like many phosphonium salts, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory practices should be followed to ensure safe handling and disposal.
Formula:C22H24P·Cl
InChI:InChI=1S/C22H24P.ClH/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,2-3,19H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=MFIUDWFSVDFDDY-UHFFFAOYSA-M
SMILES:[Cl-].C=1C=CC(=CC1)[P+](C=2C=CC=CC2)(C=3C=CC=CC3)CCCC
- Synonyms:
- Butyltriphenylphosphonium chloride
- Phosphonium, butyltriphenyl-, chloride
- Phosphonium, butyltriphenyl-, chloride (1:1)
- Triphenylbutylphosphonium chloride
- n-Butyl(triphenyl)phosphonium chloride
