CymitQuimica logo

CAS 13372-08-2

:

4-Amino-1-cyclohexene-1-carboxylic acid

Description:
4-Amino-1-cyclohexene-1-carboxylic acid is an organic compound characterized by its cyclohexene ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically a colorless to pale yellow solid, exhibiting both acidic and basic properties due to the presence of the carboxylic acid and amino groups, respectively. It is soluble in polar solvents like water and alcohols, which is common for compounds containing carboxylic acids. The presence of the amino group allows for potential interactions such as hydrogen bonding, making it reactive in various chemical reactions, including amination and carboxylation processes. This compound may also serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, given its functional groups that can participate in further chemical transformations. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H11NO2
InChI:InChI=1/C7H11NO2/c8-6-3-1-5(2-4-6)7(9)10/h1,6H,2-4,8H2,(H,9,10)
Synonyms:
  • 1-Cyclohexene-1-carboxylicacid,4-amino-(8CI)
  • 1-Cyclohexene-1-carboxylic acid, 4-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 4-Amino-1-cyclohexene-1-carboxylic Acid

    Controlled Product
    CAS:
    Formula:C7H11NO2
    Color and Shape:Neat
    Molecular weight:141.168

    Ref: TR-A604561

    500mg
    1,509.00€