CAS 13372-08-2

4-Amino-1-cyclohexene-1-carboxylic acid

Description:

4-Amino-1-cyclohexene-1-carboxylic acid is an organic compound characterized by its cyclohexene ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically a colorless to pale yellow solid, exhibiting both acidic and basic properties due to the presence of the carboxylic acid and amino groups, respectively. It is soluble in polar solvents like water and alcohols, which is common for compounds containing carboxylic acids. The presence of the amino group allows for potential interactions such as hydrogen bonding, making it reactive in various chemical reactions, including amination and carboxylation processes. This compound may also serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, given its functional groups that can participate in further chemical transformations. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₁₁NO₂

InChI: InChI=1/C7H11NO2/c8-6-3-1-5(2-4-6)7(9)10/h1,6H,2-4,8H2,(H,9,10)

Synonyms:

• 1-Cyclohexene-1-carboxylicacid,4-amino-(8CI)
• 1-Cyclohexene-1-carboxylic acid, 4-amino-

4-Amino-1-cyclohexene-1-carboxylic Acid

Controlled Product

CAS: 13372-08-2

Formula: C₇H₁₁NO₂

Color and Shape: Neat

Molecular weight: 141.168

Ref: TR-A604561