CAS 13372-18-4
:1,2-Benzenedicarboxylic acid, 1,2-dihexadecyl ester
Description:
1,2-Benzenedicarboxylic acid, 1,2-dihexadecyl ester, commonly known as dihexadecyl phthalate, is an organic compound characterized by its structure, which includes two hexadecyl (C16) alkyl chains esterified to a phthalate backbone. This compound is typically a colorless to pale yellow liquid or solid at room temperature, depending on its specific formulation and purity. It is known for its hydrophobic properties, making it insoluble in water but soluble in organic solvents. Dihexadecyl phthalate is often used as a plasticizer, enhancing the flexibility and durability of polymers, particularly in the production of flexible PVC. Additionally, it may exhibit low volatility and good thermal stability, which are advantageous in various applications. However, like many phthalates, it has raised environmental and health concerns, leading to regulatory scrutiny regarding its use in consumer products. Safety data sheets should be consulted for handling and exposure guidelines, as it may pose risks if ingested or inhaled.
Formula:C40H70O4
InChI:InChI=1S/C40H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-35-43-39(41)37-33-29-30-34-38(37)40(42)44-36-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h29-30,33-34H,3-28,31-32,35-36H2,1-2H3
InChI key:InChIKey=WKXCGJKBBBBNPF-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCCCCCCCCC)(=O)C1=C(C(OCCCCCCCCCCCCCCCC)=O)C=CC=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, dihexadecyl ester
- 1,2-Benzenedicarboxylic acid, 1,2-dihexadecyl ester
- Phthalic acid, dihexadecyl ester
- 1-Hexadecanol phthalate
- 1-Hexadecanol, phthalate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.