CAS 133720-60-2: 7-Bromobenzo[b]furan

Description:7-Bromobenzo[b]furan is a chemical compound characterized by the presence of a bromine atom attached to a benzo[b]furan structure, which consists of a fused benzene and furan ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the bromine substituent. The bromine atom can influence the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 7-Bromobenzo[b]furan may display specific physical properties such as solubility in organic solvents and a distinct melting or boiling point, which are influenced by its molecular structure. Its applications may extend to materials science and chemical research, where it can serve as a building block for more complex molecules. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal.

Formula:C₈H₅BrO

InChI:InChI=1/C8H5BrO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H

Synonyms:
7-Bromo-1-benzofuran
Benzofuran, 7-Bromo-
7-Bromobenzofuran

Found 5 products.

Product data	Purity	Price range	Estimated delivery
7-Bromobenzofuran REF: IN-DA0034E0CAS: 133720-60-2	98%	To inquire	Tue 15 Apr 25
7-Bromobenzo[b]furan REF: 54-OR15756CAS: 133720-60-2	95%	32.00 €~36.00 €	Wed 16 Apr 25
7-Bromobenzofuran REF: 10-F214846CAS: 133720-60-2	95.0%	18.00 €~452.00 €	Mon 21 Apr 25
7-Bromo-1-benzofuran REF: TR-B680483CAS: 133720-60-2	- - -	97.00 €~175.00 €	Tue 27 May 25
7-Bromo-1-benzofuran REF: 3D-IFA72060CAS: 133720-60-2	Min. 95%	- - -	Discontinued product