CAS 133720-60-2

7-Bromobenzo[b]furan

Description:

7-Bromobenzo[b]furan is a chemical compound characterized by the presence of a bromine atom attached to a benzo[b]furan structure, which consists of a fused benzene and furan ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the bromine substituent. The bromine atom can influence the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 7-Bromobenzo[b]furan may display specific physical properties such as solubility in organic solvents and a distinct melting or boiling point, which are influenced by its molecular structure. Its applications may extend to materials science and chemical research, where it can serve as a building block for more complex molecules. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal.

Formula: C₈H₅BrO

InChI: InChI=1/C8H5BrO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H

SMILES: c1cc2ccoc2c(c1)Br

Synonyms:

• 7-Bromo-1-benzofuran
• Benzofuran, 7-Bromo-
• 7-Bromobenzofuran

7-Bromobenzofuran

CAS: 133720-60-2

Formula: C₈H₅BrO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 197.0287

Ref: IN-DA0034E0

7-Bromobenzo[b]furan

CAS: 133720-60-2

7-Bromobenzo[b]furan

Formula: C₈H₅BrO

Purity: 95%

Color and Shape: clear. dark yellow liquid

Molecular weight: 197.0287g/mol

Ref: 54-OR15756

7-Bromobenzofuran

CAS: 133720-60-2

Formula: C₈H₅BrO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 197.031

Ref: 10-F214846

7-Bromo-1-benzofuran

Controlled Product

CAS: 133720-60-2

Applications 7-Bromo-1-benzofuran
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₈H₅BrO

Color and Shape: Neat

Molecular weight: 197.03

Ref: TR-B680483