
CAS 133721-88-7
:2-Fluoro-α-hydroxybenzeneacetonitrile
Description:
2-Fluoro-α-hydroxybenzeneacetonitrile, also known by its CAS number 133721-88-7, is an organic compound characterized by the presence of a fluorine atom, a hydroxyl group, and a nitrile functional group attached to a benzene ring. This compound features a fluorinated aromatic system, which can influence its reactivity and interaction with biological systems. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitrile group can participate in various chemical reactions, including nucleophilic additions and substitutions. The presence of the fluorine atom may enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the overall molecular structure. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C8H6FNO
InChI:InChI=1S/C8H6FNO/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,11H
InChI key:InChIKey=SDADKJCPTQNFRZ-UHFFFAOYSA-N
SMILES:C(C#N)(O)C1=C(F)C=CC=C1
Synonyms:- 2-(2-Fluorophenyl)-2-hydroxyacetonitrile
- Benzeneacetonitrile, 2-fluoro-α-hydroxy-
- 2-Fluorobenzaldehyde cyanohydrin
- 2-Fluoro-α-hydroxybenzeneacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
