CAS 133728-27-5

Carbamic acid, (9-oxononyl)-, 1,1-dimethylethyl ester

Description:

Carbamic acid, (9-oxononyl)-, 1,1-dimethylethyl ester, with the CAS number 133728-27-5, is an organic compound that belongs to the class of carbamates. This substance features a carbamic acid moiety, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N) that is also bonded to an alkyl or aryl group. The specific structure of this compound includes a nonyl chain with a ketone functional group at the 9-position, contributing to its unique properties. The presence of the tert-butyl ester group indicates that it has a bulky substituent, which can influence its solubility and reactivity. Generally, carbamates are known for their applications in agriculture as pesticides and herbicides, as well as in the synthesis of pharmaceuticals. The physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure of the compound. Safety data and handling precautions should be consulted due to potential toxicity associated with carbamate derivatives.

Formula: C₁₄H₂₇NO₃

InChI: InChI=1S/C14H27NO3/c1-14(2,3)18-13(17)15-11-9-7-5-4-6-8-10-12-16/h12H,4-11H2,1-3H3,(H,15,17)

InChI key: InChIKey=ORHUSMLNPOLNLC-UHFFFAOYSA-N

SMILES: C(NCCCCCCCCC=O)(OC(C)(C)C)=O

Synonyms:

• Carbamic acid, (9-oxononyl)-, 1,1-dimethylethyl ester

tert-Butyl (9-oxononyl)carbamate

CAS: 133728-27-5

tert-Butyl (9-oxononyl)carbamate

Purity: 97%

Molecular weight: 257.37g/mol

Ref: 54-OR1058752