CymitQuimica logo

CAS 13373-11-0

:

2-chloro-5-phenyl-1,3,4-thiadiazole

Description:
2-Chloro-5-phenyl-1,3,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. The compound features a chlorine atom at the 2-position and a phenyl group at the 5-position of the thiadiazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the phenyl group can enhance the compound's stability and may impart specific electronic properties. 2-Chloro-5-phenyl-1,3,4-thiadiazole is of interest in medicinal chemistry and materials science due to its potential applications in pharmaceuticals and as a building block for more complex organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H5ClN2S
InChI:InChI=1/C8H5ClN2S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H
InChI key:ASSPGHHANNDMET-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1nnc(Cl)s1
Synonyms:
  • Nsc 75707
  • 2-Chloro-5-phenyl-1,3,4-thiadiazole
Found 4 products.