CAS 133730-34-4
:2,4-Dimethoxybenzeneboronic acid
Description:
2,4-Dimethoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a dimethoxy-substituted benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. The methoxy groups enhance the electron density of the aromatic ring, influencing its reactivity and stability. Additionally, 2,4-Dimethoxybenzeneboronic acid can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. Its properties, such as melting point and solubility, can vary based on purity and environmental conditions. As with many boronic acids, it is important to handle this compound with care, as it may exhibit sensitivity to moisture and air, which can affect its stability and reactivity.
Formula:C8H11BO4
InChI:InChI=1/C8H11BO4/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5,10-11H,1-2H3
SMILES:COc1ccc(c(c1)OC)B(O)O
Synonyms:- 2,4-Dimethoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Dimethoxybenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11BO4Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to pale creamMolecular weight:181.982,4-Dimethoxyphenylboronic acid
CAS:Formula:C8H11BO4Purity:98%Color and Shape:SolidMolecular weight:181.98152,4-Dimethoxybenzeneboronic acid
CAS:2,4-Dimethoxybenzeneboronic acidFormula:C8H11BO4Purity:≥95%Color and Shape: white to beige powderMolecular weight:181.98g/mol2,4-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO4Purity:97.0 to 111.0 %Color and Shape:White to Dark green powder to crystalMolecular weight:181.982,4-Dimethoxybenzeneboronic acid
CAS:Formula:C8H11BO4Purity:95%Color and Shape:SolidMolecular weight:181.98





