CAS 13374-44-2
:2,6-bis(oxiran-2-ylmethoxy)-4,8-dioxabicyclo[3.3.0]octane
Description:
2,6-bis(oxiran-2-ylmethoxy)-4,8-dioxabicyclo[3.3.0]octane, with CAS number 13374-44-2, is a chemical compound characterized by its bicyclic structure, which includes two epoxide (oxirane) groups. This compound features a unique arrangement of ether linkages and a bicyclo[3.3.0]octane framework, contributing to its potential reactivity and stability. The presence of epoxide groups suggests that it may participate in various chemical reactions, such as ring-opening reactions, making it useful in polymer chemistry and as a building block in organic synthesis. Its dioxabicyclic structure may impart specific physical properties, such as solubility and melting point, which are influenced by the overall molecular geometry and functional groups. Additionally, the compound's potential applications could extend to fields like materials science and medicinal chemistry, where its unique structure may offer advantageous properties for developing new materials or pharmaceuticals. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary for a comprehensive understanding of its characteristics.
Formula:C12H18O6
InChI:InChI=1/C12H18O6/c1-7(13-1)3-15-9-5-17-12-10(6-18-11(9)12)16-4-8-2-14-8/h7-12H,1-6H2
Synonyms:- 1,4:3,6-dianhydro-2,5-bis-O-(oxiran-2-ylmethyl)hexitol
- D-Glucitol, 1,4:3,6-dianhydro-2,5-bis-O-(2-oxiranylmethyl)-
- diglycidyl dianhydrohexanehexol
- 2,6-bis(oxiran-2-ylmethoxy)-4,8-dioxabicyclo[3.3.0]octane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isosorbide diglycidyl ether
CAS:Please enquire for more information about Isosorbide diglycidyl ether including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H18O6Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:258.27 g/mol

