CAS 133748-22-8

1-(2,4-DIMETHYL-PHENYL)-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID

Description:

1-(2,4-Dimethyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid, with the CAS number 133748-22-8, is a chemical compound characterized by its pyrrolidine core, which is a five-membered nitrogen-containing ring. The presence of a 2,4-dimethylphenyl group indicates that the compound has aromatic characteristics, contributing to its stability and potential reactivity. The "5-oxo" designation suggests that there is a carbonyl group (C=O) at the fifth position of the pyrrolidine ring, which can influence the compound's reactivity and interactions with other molecules. Additionally, the carboxylic acid functional group at the third position indicates that the compound can participate in acid-base reactions and may exhibit solubility in polar solvents. This compound may be of interest in pharmaceutical research due to its structural features, which could lead to various biological activities. Its specific properties, such as melting point, boiling point, and solubility, would require empirical data for precise characterization.

Formula: C₁₃H₁₄NO₃

InChI: InChI=1/C13H15NO3/c1-8-3-4-11(9(2)5-8)14-7-10(13(16)17)6-12(14)15/h3-5,10H,6-7H2,1-2H3,(H,16,17)/p-1/t10-/m1/s1

SMILES: Cc1ccc(c(C)c1)N1C[C@@H](CC1=O)C(=O)[O-]

Synonyms:

• Akos Bb-6995
• (3S)-1-(2,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate
• (3R)-1-(2,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate