CAS 133748-23-9
:Methyl 1-(2,4-dimethylphenyl)-5-oxo-3-pyrrolidinecarboxylate
Description:
Methyl 1-(2,4-dimethylphenyl)-5-oxo-3-pyrrolidinecarboxylate, with the CAS number 133748-23-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 2,4-dimethylphenyl substituent indicates that it has aromatic characteristics, which can influence its electronic properties and interactions with other molecules. The oxo group (carbonyl) at the 5-position of the pyrrolidine ring suggests potential for further chemical transformations, such as nucleophilic attacks or condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest in various chemical research fields.
Formula:C14H17NO3
InChI:InChI=1S/C14H17NO3/c1-9-4-5-12(10(2)6-9)15-8-11(7-13(15)16)14(17)18-3/h4-6,11H,7-8H2,1-3H3
InChI key:InChIKey=RWXBNEKRLGUVRW-UHFFFAOYSA-N
SMILES:O=C1N(CC(C(OC)=O)C1)C2=C(C)C=C(C)C=C2
Synonyms:- Methyl 1-(2,4-dimethylphenyl)-5-oxo-3-pyrrolidinecarboxylate
- 3-Pyrrolidinecarboxylic acid, 1-(2,4-dimethylphenyl)-5-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.