CymitQuimica logo

CAS 133766-36-6

:

ethyl 2-amino-3-(5-bromo-1H-indol-3-yl)propanoate

Description:
Ethyl 2-amino-3-(5-bromo-1H-indol-3-yl)propanoate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a brominated indole moiety. The presence of the bromine atom at the 5-position of the indole ring contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The amino group can participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the ethyl ester group may undergo hydrolysis, leading to the release of the corresponding carboxylic acid and ethanol. Overall, ethyl 2-amino-3-(5-bromo-1H-indol-3-yl)propanoate is of interest for its potential therapeutic properties and as a building block in organic synthesis.
Formula:C13H15BrN2O2
InChI:InChI=1/C13H15BrN2O2/c1-2-18-13(17)11(15)5-8-7-16-12-4-3-9(14)6-10(8)12/h3-4,6-7,11,16H,2,5,15H2,1H3
Synonyms:
  • Ethyl 5-bromotryptophanate
  • tryptophan, 5-bromo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.