CAS 133768-71-5
:3-[(3-[4-chloro-2-(dimethylcarbamoyl)phenyl]-1-{3-[(7-chloroquinolin-2-yl)methoxy]phenyl}propyl)sulfanyl]propanoic acid
Description:
The chemical substance known as 3-[(3-[4-chloro-2-(dimethylcarbamoyl)phenyl]-1-{3-[(7-chloroquinolin-2-yl)methoxy]phenyl}propyl)sulfanyl]propanoic acid, with the CAS number 133768-71-5, is a complex organic compound characterized by its multi-functional structure. It features a propanoic acid backbone, which is a carboxylic acid, indicating potential acidic properties. The presence of a sulfanyl group suggests that it may exhibit thiol-like reactivity, potentially participating in redox reactions or forming disulfide bonds. The compound also contains multiple aromatic rings, which can contribute to its stability and influence its electronic properties. The chlorinated and dimethylcarbamoyl substituents may enhance its biological activity, making it of interest in medicinal chemistry. Overall, this compound's intricate structure implies potential applications in pharmaceuticals, particularly in the development of targeted therapies, though its specific biological activity and interactions would require further investigation through experimental studies.
Formula:C31H30Cl2N2O4S
InChI:InChI=1/C31H30Cl2N2O4S/c1-35(2)31(38)27-17-23(32)10-6-20(27)9-13-29(40-15-14-30(36)37)22-4-3-5-26(16-22)39-19-25-12-8-21-7-11-24(33)18-28(21)34-25/h3-8,10-12,16-18,29H,9,13-15,19H2,1-2H3,(H,36,37)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L 686741
CAS:L 686741 is a bioactive chemical.Formula:C31H30Cl2N2O4SColor and Shape:SolidMolecular weight:597.55
