CymitQuimica logo

CAS 133775-26-5

:

2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, 3-methanesulfonate, [R-(R*,R*)]-

Description:
2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, 3-methanesulfonate, with CAS number 133775-26-5, is a chemical compound characterized by its complex structure, which includes a butanediol backbone, a difluorophenyl group, and a triazole moiety. This compound is typically classified as a sulfonate ester, indicating the presence of a sulfonate group that can enhance its solubility and reactivity. The difluorophenyl substituent may impart unique electronic properties, potentially influencing its biological activity or interaction with other molecules. The triazole ring is known for its role in various pharmacological applications, often contributing to the compound's potential as a therapeutic agent. Additionally, the stereochemistry indicated by the [R-(R*,R*)] notation suggests that the compound has specific chiral centers, which can affect its biological activity and interactions. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its unique structural features may be leveraged for specific applications.
Formula:C13H15F2N3O4S
InChI:InChI=1S/C13H15F2N3O4S/c1-9(22-23(2,20)21)13(19,6-18-8-16-7-17-18)11-4-3-10(14)5-12(11)15/h3-5,7-9,19H,6H2,1-2H3/t9-,13-/m1/s1
InChI key:InChIKey=SFXKCYSWTNZNHM-NOZJJQNGSA-N
SMILES:[C@](CN1C=NC=N1)([C@H](OS(C)(=O)=O)C)(O)C2=C(F)C=C(F)C=C2
Synonyms:
  • 2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, 3-methanesulfonate, [R-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.