CAS 1337879-49-8

1,1-Dimethylethyl 3-[[(trifluoromethyl)sulfonyl]oxy]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[[[trifluoromethyl)sulfonyl]oxy]-1-pyrrolidinecarboxylate, identified by its CAS number 1337879-49-8, is a chemical compound characterized by its unique functional groups and structure. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a carboxylate group and a trifluoromethylsulfonyl moiety. The presence of the trifluoromethyl group imparts significant electronegativity and lipophilicity, enhancing the compound's reactivity and potential applications in medicinal chemistry and agrochemicals. The dimethyl group contributes to steric hindrance, which can influence the compound's interaction with biological targets. This compound may exhibit properties such as solubility in organic solvents and stability under various conditions, making it suitable for synthesis and formulation in chemical processes. Its specific applications and biological activity would depend on further studies, including its interaction with enzymes or receptors, which could reveal its potential as a pharmaceutical agent or a chemical intermediate.

Formula: C₁₀H₁₆F₃NO₅S

InChI: InChI=1S/C10H16F3NO5S/c1-9(2,3)18-8(15)14-5-4-7(6-14)19-20(16,17)10(11,12)13/h7H,4-6H2,1-3H3

InChI key: InChIKey=JVOWNVINJRINTN-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(OS(C(F)(F)F)(=O)=O)CC1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-[[(trifluoromethyl)sulfonyl]oxy]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[[(trifluoromethyl)sulfonyl]oxy]-1-pyrrolidinecarboxylate