CAS 1337879-68-1

3-Amino-6-isoquinolinecarbonitrile

Description:

3-Amino-6-isoquinolinecarbonitrile is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety and a cyano group. This compound features an amino group at the 3-position of the isoquinoline ring, contributing to its potential reactivity and biological activity. The presence of the cyano group at the 6-position enhances its chemical properties, making it a valuable intermediate in organic synthesis and medicinal chemistry. Typically, compounds like this exhibit moderate to high solubility in polar organic solvents, and their reactivity can be influenced by the functional groups present. The compound may also display interesting pharmacological properties, making it a subject of interest in drug discovery and development. Its specific applications can vary, but it is often explored for potential use in the synthesis of more complex molecules or as a lead compound in therapeutic research. As with many nitrogen-containing heterocycles, it may also exhibit fluorescence or other optical properties, depending on its environment and substituents.

Formula: C₁₀H₇N₃

InChI: InChI=1S/C10H7N3/c11-5-7-1-2-8-6-13-10(12)4-9(8)3-7/h1-4,6H,(H2,12,13)

InChI key: InChIKey=YVDSTDSDVBTLRD-UHFFFAOYSA-N

SMILES: C(#N)C1=CC2=C(C=C1)C=NC(N)=C2

Synonyms:

• 3-Amino-6-isoquinolinecarbonitrile
• 6-Isoquinolinecarbonitrile, 3-amino-