CAS 1337879-86-3

1-Chloro-8-isoquinolinecarboxaldehyde

Description:

1-Chloro-8-isoquinolinecarboxaldehyde is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound includes a chloro substituent and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloro group enhances electrophilicity, making it useful in nucleophilic substitution reactions. The aldehyde group allows for further functionalization, enabling the synthesis of various derivatives. Typically, compounds like this exhibit moderate to high polarity due to the presence of the polar aldehyde group, influencing their solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its unique structure and functional groups suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₆ClNO

InChI: InChI=1S/C10H6ClNO/c11-10-9-7(4-5-12-10)2-1-3-8(9)6-13/h1-6H

InChI key: InChIKey=RBENJZULBCCIHO-UHFFFAOYSA-N

SMILES: C(=O)C=1C2=C(C=CC1)C=CN=C2Cl

Synonyms:

• 8-Isoquinolinecarboxaldehyde, 1-chloro-
• 1-Chloro-8-isoquinolinecarboxaldehyde