CAS 1337879-95-4

Benzenemethanamine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1), also known by its CAS number 1337879-95-4, is a chemical compound characterized by its amine functional group and a cyclopropylmethoxy substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the cyclopropyl group introduces unique steric and electronic properties, potentially influencing its biological activity and interactions. As a hydrochloride salt, it is often more stable and easier to handle than its base form. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. However, detailed studies on its pharmacological properties, toxicity, and applications would be necessary to fully understand its potential uses in medicinal chemistry.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c12-7-9-3-5-11(6-4-9)13-8-10-1-2-10;/h3-6,10H,1-2,7-8,12H2;1H

InChI key: InChIKey=NXBCFIPMHVMNDC-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(CN)C=C1)C2CC2.Cl

Synonyms:

• Benzenemethanamine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1)