CAS 1337880-15-5

2′-(2,6-Dichlorophenyl)-2,4′-bi-3H-imidazo[4,5-c]pyridine

Description:

2′-(2,6-Dichlorophenyl)-2,4′-bi-3H-imidazo[4,5-c]pyridine is a synthetic organic compound characterized by its complex bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a dichlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of chlorine atoms enhances its electronic properties, potentially influencing its reactivity and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. The imidazo[4,5-c]pyridine framework is known for its ability to interact with various biological receptors, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and overall behavior in biological systems would depend on its specific functional groups and molecular interactions. As with many synthetic compounds, safety and toxicity assessments are crucial for understanding its potential applications in pharmaceuticals or other fields.

Formula: C₁₈H₁₀Cl₂N₆

InChI: InChI=1S/C18H10Cl2N6/c19-9-2-1-3-10(20)14(9)17-24-12-5-7-22-16(15(12)26-17)18-23-11-4-6-21-8-13(11)25-18/h1-8H,(H,23,25)(H,24,26)

InChI key: InChIKey=RHPNUGOKIZRANZ-UHFFFAOYSA-N

SMILES: ClC1=C(C2=NC3=C(N=CC=C3N2)C=4NC=5C(N4)=CN=CC5)C(Cl)=CC=C1

Synonyms:

• 2,4′-Bi-3H-imidazo[4,5-c]pyridine, 2′-(2,6-dichlorophenyl)-
• 2′-(2,6-Dichlorophenyl)-2,4′-bi-3H-imidazo[4,5-c]pyridine