
CAS 1337880-32-6
:4-Methoxy-1-methyl-1H-indazole
Description:
4-Methoxy-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methoxy group (-OCH3) at the 4-position and a methyl group (-CH3) at the 1-position contributes to its unique properties. This compound is typically classified as an indazole derivative, which may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and it may be investigated for its effects in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings. Overall, 4-Methoxy-1-methyl-1H-indazole represents a specific class of organic molecules with potential applications in drug development and research.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-11-8-4-3-5-9(12-2)7(8)6-10-11/h3-6H,1-2H3
InChI key:InChIKey=HNBWCSXHZYLBFQ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(N(C)N=C2)=CC=C1
Synonyms:- 4-Methoxy-1-methyl-1H-indazole
- 1H-Indazole, 4-methoxy-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
