
CAS 1337880-34-8
:3-Amino-8-isoquinolinecarbonitrile
Description:
3-Amino-8-isoquinolinecarbonitrile is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety and a cyano group. This compound features an amino group at the 3-position of the isoquinoline ring, contributing to its potential reactivity and biological activity. The presence of the cyano group enhances its utility in various synthetic applications, particularly in medicinal chemistry, where it may serve as a building block for the development of pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be exploited in materials science and organic electronics. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H7N3
InChI:InChI=1S/C10H7N3/c11-5-8-3-1-2-7-4-10(12)13-6-9(7)8/h1-4,6H,(H2,12,13)
InChI key:InChIKey=IWYIBAOIOZIXJN-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C=C(N)N=C2)C=CC1
Synonyms:- 3-Amino-8-isoquinolinecarbonitrile
- 8-Isoquinolinecarbonitrile, 3-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.