CAS 1337880-44-0

1,1-Dimethylethyl 6-methyl-1H-indazole-1-carboxylate

Description:

1,1-Dimethylethyl 6-methyl-1H-indazole-1-carboxylate, identified by its CAS number 1337880-44-0, is a chemical compound that belongs to the class of indazole derivatives. This substance features a carboxylate functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the dimethyl group indicates steric hindrance, which can influence the compound's biological activity and interaction with other molecules. Indazoles are known for their diverse pharmacological properties, including anti-inflammatory and anticancer activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests that it may exhibit lipophilic characteristics, potentially affecting its bioavailability and distribution in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1,1-Dimethylethyl 6-methyl-1H-indazole-1-carboxylate represents a unique structure that may have significant implications in research and development within the pharmaceutical industry.

Formula: C₁₃H₁₆N₂O₂

InChI: InChI=1S/C13H16N2O2/c1-9-5-6-10-8-14-15(11(10)7-9)12(16)17-13(2,3)4/h5-8H,1-4H3

InChI key: InChIKey=JEGCBRKBVNIXPZ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(=CC=C(C)C2)C=N1

Synonyms:

• 1,1-Dimethylethyl 6-methyl-1H-indazole-1-carboxylate
• 1H-Indazole-1-carboxylic acid, 6-methyl-, 1,1-dimethylethyl ester