CymitQuimica logo

CAS 1337880-59-7

:

7-Methoxypyrido[2,3-b]pyrazine

Description:
7-Methoxypyrido[2,3-b]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine and a pyrazine ring fused together. This compound features a methoxy group (-OCH3) attached to the pyridine ring, which can influence its chemical reactivity and solubility. The presence of nitrogen atoms in both rings contributes to its basicity and potential interactions with various biological targets. Typically, compounds like 7-Methoxypyrido[2,3-b]pyrazine may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. Its molecular structure allows for diverse applications, including potential use in agrochemicals or as a building block in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other chemical entities. Overall, 7-Methoxypyrido[2,3-b]pyrazine represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c1-12-6-4-7-8(11-5-6)10-3-2-9-7/h2-5H,1H3
InChI key:InChIKey=KJVAIMFKHIXADT-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(N=C1)N=CC=N2
Synonyms:
  • 7-Methoxypyrido[2,3-b]pyrazine
  • Pyrido[2,3-b]pyrazine, 7-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.