CAS 1337880-77-9

3-Iodo-1-methyl-1H-indazol-7-amine

Description:

3-Iodo-1-methyl-1H-indazol-7-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an iodine atom at the 3-position and a methyl group at the 1-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many indazole derivatives. The amino group at the 7-position can participate in hydrogen bonding and may influence the compound's biological activity. Compounds like 3-Iodo-1-methyl-1H-indazol-7-amine are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its structural features may also allow for interactions with specific receptors or enzymes, making it a candidate for further research in drug discovery. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₈H₈IN₃

InChI: InChI=1S/C8H8IN3/c1-12-7-5(8(9)11-12)3-2-4-6(7)10/h2-4H,10H2,1H3

InChI key: InChIKey=RDDYTAQHKWXDLB-UHFFFAOYSA-N

SMILES: NC1=C2C(C(I)=NN2C)=CC=C1

Synonyms:

• 1H-Indazol-7-amine, 3-iodo-1-methyl-
• 3-Iodo-1-methyl-1H-indazol-7-amine