CAS 1337880-78-0

3-Pyrrolidinylmethyl 1,1,1-trifluoromethanesulfonate

Description:

3-Pyrrolidinylmethyl 1,1,1-trifluoromethanesulfonate, identified by its CAS number 1337880-78-0, is a chemical compound characterized by the presence of a pyrrolidine ring and a trifluoromethanesulfonate functional group. This compound typically exhibits properties associated with both its pyrrolidine structure, which is a five-membered nitrogen-containing heterocycle, and the trifluoromethanesulfonate moiety, known for its strong electrophilic character. The trifluoromethanesulfonate group enhances the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. Additionally, the presence of fluorine atoms contributes to the compound's stability and lipophilicity, which can influence its behavior in biological systems. Overall, this compound is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications in drug development and synthesis.

Formula: C₆H₁₀F₃NO₃S

InChI: InChI=1S/C6H10F3NO3S/c7-6(8,9)14(11,12)13-4-5-1-2-10-3-5/h5,10H,1-4H2

InChI key: InChIKey=PKIIOOKJXJVLCD-UHFFFAOYSA-N

SMILES: C(OS(C(F)(F)F)(=O)=O)C1CCNC1

Synonyms:

• Trifluoro-methanesulfonic acid pyrrolidin-3-ylmethyl ester
• Methanesulfonic acid, 1,1,1-trifluoro-, 3-pyrrolidinylmethyl ester
• 3-Pyrrolidinylmethyl 1,1,1-trifluoromethanesulfonate