
CAS 1337881-09-0
:1,1-Dimethylethyl N-(5-hydroxy-2-pyridinyl)-N-methylcarbamate
Description:
1,1-Dimethylethyl N-(5-hydroxy-2-pyridinyl)-N-methylcarbamate, identified by its CAS number 1337881-09-0, is a chemical compound characterized by its unique structure, which includes a carbamate functional group. This compound features a dimethylated tert-butyl group, contributing to its hydrophobic properties, alongside a pyridine ring that contains a hydroxyl group, which can participate in hydrogen bonding. The presence of the N-methyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals, particularly due to their ability to interact with biological systems. The molecular interactions can be influenced by the steric and electronic effects of the substituents, making it a subject of interest in medicinal chemistry. Additionally, the stability and reactivity of this compound can be affected by environmental factors, which is crucial for understanding its behavior in various applications. Overall, this compound exemplifies the complexity and diversity of organic molecules used in chemical research and development.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-11(2,3)16-10(15)13(4)9-6-5-8(14)7-12-9/h5-7,14H,1-4H3
InChI key:InChIKey=HJGLZKRZMNIOIO-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(C)C1=CC=C(O)C=N1
Synonyms:- 1,1-Dimethylethyl N-(5-hydroxy-2-pyridinyl)-N-methylcarbamate
- Carbamic acid, N-(5-hydroxy-2-pyridinyl)-N-methyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.