CAS 1337881-11-4

3-Iodo-1-methyl-1H-indazol-6-amine

Description:

3-Iodo-1-methyl-1H-indazol-6-amine is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of an iodine atom at the 3-position and a methyl group at the 1-position contributes to its unique reactivity and potential biological activity. The amine functional group at the 6-position enhances its solubility in polar solvents and may facilitate interactions with biological targets. This compound is often studied in the context of medicinal chemistry due to its potential applications in drug development, particularly in targeting specific enzymes or receptors. Its molecular structure suggests that it may exhibit interesting pharmacological properties, including anti-cancer or anti-inflammatory activities. Additionally, the presence of halogens like iodine can influence the compound's lipophilicity and metabolic stability. As with many indazole derivatives, the synthesis and characterization of 3-Iodo-1-methyl-1H-indazol-6-amine are of interest in both academic and industrial research settings.

Formula: C₈H₈IN₃

InChI: InChI=1S/C8H8IN3/c1-12-7-4-5(10)2-3-6(7)8(9)11-12/h2-4H,10H2,1H3

InChI key: InChIKey=FBUFSUGMFIDOHR-UHFFFAOYSA-N

SMILES: CN1C=2C(C(I)=N1)=CC=C(N)C2

Synonyms:

• 3-Iodo-1-methyl-1H-indazol-6-amine
• 1H-Indazol-6-amine, 3-iodo-1-methyl-