CAS 1337881-25-0
:8-Isoquinolinecarboxamide
Description:
8-Isoquinolinecarboxamide is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound derived from quinoline. This substance typically features a carboxamide functional group (-C(=O)NH2) attached to the isoquinoline ring, influencing its chemical reactivity and potential biological activity. The presence of the isoquinoline moiety suggests that it may exhibit properties relevant to medicinal chemistry, including potential interactions with biological targets. The compound may be soluble in organic solvents, and its solubility in water can vary depending on the specific substituents and their positions on the isoquinoline ring. Additionally, 8-Isoquinolinecarboxamide may possess interesting pharmacological properties, making it a subject of interest in drug discovery and development. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or selectivity for specific biological pathways. Overall, 8-Isoquinolinecarboxamide represents a versatile scaffold in organic and medicinal chemistry.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-10(13)8-3-1-2-7-4-5-12-6-9(7)8/h1-6H,(H2,11,13)
InChI key:InChIKey=LLVBUQHDQQCEAO-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C2=C(C=CC1)C=CN=C2
Synonyms:- 8-Isoquinolinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
