CymitQuimica logo

CAS 1337881-26-1

:

4-Bromo-7-methyl-1H-indazol-3-amine

Description:
4-Bromo-7-methyl-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position and a methyl group at the 7-position contributes to its unique reactivity and properties. This compound features an amine functional group at the 3-position, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activity. The compound's molecular structure suggests it may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 4-Bromo-7-methyl-1H-indazol-3-amine represents a valuable compound for further exploration in chemical and pharmaceutical applications.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-4-2-3-5(9)6-7(4)11-12-8(6)10/h2-3H,1H3,(H3,10,11,12)
InChI key:InChIKey=JNXRSCGSFOUEOQ-UHFFFAOYSA-N
SMILES:CC1=C2C(C(N)=NN2)=C(Br)C=C1
Synonyms:
  • 4-Bromo-7-methyl-1H-indazol-3-amine
  • 1H-Indazol-3-amine, 4-bromo-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.