CAS 1337881-55-6
:4-Bromo-3-chloro-1-methyl-1H-indazole
Description:
4-Bromo-3-chloro-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and chlorine substituents at the 4 and 3 positions, respectively, contributes to its reactivity and potential applications in various fields, including medicinal chemistry and material science. The methyl group at the 1-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its molecular structure suggests potential interactions with biological targets, and its halogen substituents may play a role in modulating these interactions. As with many halogenated compounds, it is essential to consider the environmental and health implications associated with its use and disposal. Overall, 4-Bromo-3-chloro-1-methyl-1H-indazole represents a versatile scaffold for further chemical exploration and application.
Formula:C8H6BrClN2
InChI:InChI=1S/C8H6BrClN2/c1-12-6-4-2-3-5(9)7(6)8(10)11-12/h2-4H,1H3
InChI key:InChIKey=QGLLFLHUMXEPFK-UHFFFAOYSA-N
SMILES:BrC1=C2C(N(C)N=C2Cl)=CC=C1
Synonyms:- 4-Bromo-3-chloro-1-methyl-1H-indazole
- 1H-Indazole, 4-bromo-3-chloro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.