CymitQuimica logo

CAS 1337881-59-0

:

α,2-Dimethyl-2H-indazole-5-methanol

Description:
α,2-Dimethyl-2H-indazole-5-methanol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two methyl groups at the 2-position and a hydroxymethyl group at the 5-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been studied for various biological activities. The compound's reactivity may be influenced by the presence of the hydroxymethyl group, which can participate in further chemical transformations. Additionally, the compound's stability and behavior under different conditions, such as temperature and pH, would be important for its practical applications. Overall, α,2-Dimethyl-2H-indazole-5-methanol represents a versatile structure with potential implications in chemical research and drug development.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-7(13)8-3-4-10-9(5-8)6-12(2)11-10/h3-7,13H,1-2H3
InChI key:InChIKey=LTOREGAVPRCYMQ-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC=2C(C=C1)=NN(C)C2
Synonyms:
  • 2H-Indazole-5-methanol, α,2-dimethyl-
  • α,2-Dimethyl-2H-indazole-5-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.