CymitQuimica logo

CAS 1337881-76-1

:

4-Methyl-8-isoquinolinesulfonyl chloride

Description:
4-Methyl-8-isoquinolinesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to an isoquinoline structure. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonyl groups into various substrates. The isoquinoline moiety contributes to its potential biological activity, as many isoquinoline derivatives exhibit pharmacological properties. Additionally, this compound may be sensitive to moisture and should be handled with care, as sulfonyl chlorides can release hydrochloric acid upon hydrolysis. Proper storage conditions are essential to maintain its stability and reactivity. Overall, 4-Methyl-8-isoquinolinesulfonyl chloride serves as a valuable intermediate in the synthesis of more complex organic molecules, particularly in medicinal chemistry and material science.
Formula:C10H8ClNO2S
InChI:InChI=1S/C10H8ClNO2S/c1-7-5-12-6-9-8(7)3-2-4-10(9)15(11,13)14/h2-6H,1H3
InChI key:InChIKey=HNKXDDMSVNPLTL-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C2=C(C(C)=CN=C2)C=CC1
Synonyms:
  • 4-Methyl-8-isoquinolinesulfonyl chloride
  • 8-Isoquinolinesulfonyl chloride, 4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.