
CAS 1337881-89-6
:5-Ethyl 2-methyl 1H-imidazole-2,5-dicarboxylate
Description:
5-Ethyl 2-methyl 1H-imidazole-2,5-dicarboxylate is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two carboxylate groups, which contribute to its acidic properties and potential for forming salts or esters. The presence of ethyl and methyl substituents on the imidazole ring enhances its lipophilicity and may influence its reactivity and solubility in various solvents. The compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the functional groups present. It may participate in various chemical reactions, including esterification and nucleophilic substitutions, making it of interest in organic synthesis and medicinal chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and interactions. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C8H10N2O4
InChI:InChI=1S/C8H10N2O4/c1-3-14-7(11)5-4-9-6(10-5)8(12)13-2/h4H,3H2,1-2H3,(H,9,10)
InChI key:InChIKey=MAMKOXYWMKOQOK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1NC(C(OC)=O)=NC1
Synonyms:- 5-Ethyl 2-methyl 1H-imidazole-2,5-dicarboxylate
- 1H-Imidazole-2,5-dicarboxylic acid, 5-ethyl 2-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.