CAS 1337882-12-8

3-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole

Description:

3-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole is a chemical compound characterized by its unique structural features, which include an indazole core and a tetrahydro-2H-pyran substituent. The presence of the iodine atom at the 3-position of the indazole ring enhances its reactivity and can influence its biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen atoms in its structure. The tetrahydro-2H-pyran moiety contributes to the compound's overall stability and solubility properties. It may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular interactions, such as hydrogen bonding and π-π stacking, can play a significant role in its behavior in biological systems. As with many indazole derivatives, it may have potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies are necessary to fully understand its properties and potential uses in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₁₃IN₂O

InChI: InChI=1S/C12H13IN2O/c13-12-9-5-1-2-6-10(9)15(14-12)11-7-3-4-8-16-11/h1-2,5-6,11H,3-4,7-8H2

InChI key: InChIKey=YUBLZHLSCACZQU-UHFFFAOYSA-N

SMILES: IC1=NN(C=2C1=CC=CC2)C3CCCCO3

Synonyms:

• 3-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole
• IB-1-18
• 1H-Indazole, 3-iodo-1-(tetrahydro-2H-pyran-2-yl)-