CAS 1337882-44-6

2,6-Dichloro-4-(1H-1,2,4-triazol-5-yl)benzenamine

Description:

2,6-Dichloro-4-(1H-1,2,4-triazol-5-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two chlorine atoms and an amino group, along with a triazole moiety. The presence of the dichloro substituents indicates that it may exhibit significant reactivity and potential biological activity, as halogenated compounds often play important roles in pharmaceuticals and agrochemicals. The triazole ring contributes to its heterocyclic nature, which can enhance solubility and stability in various environments. This compound may be of interest in research related to medicinal chemistry, particularly for its potential applications in antifungal or herbicidal activities. Its molecular interactions, such as hydrogen bonding and π-π stacking, could influence its behavior in biological systems. Additionally, the specific arrangement of functional groups suggests that it may participate in various chemical reactions, making it a candidate for further investigation in synthetic chemistry and material science. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose health risks.

Formula: C₈H₆Cl₂N₄

InChI: InChI=1S/C8H6Cl2N4/c9-5-1-4(2-6(10)7(5)11)8-12-3-13-14-8/h1-3H,11H2,(H,12,13,14)

InChI key: InChIKey=HJIBPVUTLSXJJI-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(Cl)C1N)C=2NC=NN2

Synonyms:

• Benzenamine, 2,6-dichloro-4-(1H-1,2,4-triazol-5-yl)-
• 2,6-Dichloro-4-(1H-1,2,4-triazol-5-yl)benzenamine