CAS 1337882-52-6
:2-(2,6-Dichlorophenyl)isothiazolo[5,4-c]pyridin-3(2H)-one
Description:
2-(2,6-Dichlorophenyl)isothiazolo[5,4-c]pyridin-3(2H)-one is a heterocyclic compound characterized by its unique isothiazole and pyridine ring structures. This compound features a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of chlorine atoms enhances its reactivity and may influence its interaction with biological targets. The isothiazole moiety is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's molecular structure suggests it may exhibit significant stability under various conditions, although specific stability data would depend on environmental factors. Additionally, its potential applications in medicinal chemistry could be explored, particularly in the development of novel therapeutic agents. Overall, 2-(2,6-Dichlorophenyl)isothiazolo[5,4-c]pyridin-3(2H)-one represents a class of compounds that may offer valuable insights into drug discovery and development, warranting further investigation into its chemical behavior and biological effects.
Formula:C12H6Cl2N2OS
InChI:InChI=1S/C12H6Cl2N2OS/c13-8-2-1-3-9(14)11(8)16-12(17)7-4-5-15-6-10(7)18-16/h1-6H
InChI key:InChIKey=LIVXQXDSWKSPEZ-UHFFFAOYSA-N
SMILES:O=C1N(SC=2C1=CC=NC2)C3=C(Cl)C=CC=C3Cl
Synonyms:- Isothiazolo[5,4-c]pyridin-3(2H)-one, 2-(2,6-dichlorophenyl)-
- 2-(2,6-Dichlorophenyl)isothiazolo[5,4-c]pyridin-3(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.