CAS 13379-63-0
:1,10-BIS-(1-HYDROXY-2-NAPHTHYL)-1,10-DECANEDIONE
Description:
1,10-Bis-(1-hydroxy-2-naphthyl)-1,10-decanedione, identified by CAS number 13379-63-0, is an organic compound characterized by its complex structure featuring two naphthol moieties connected by a decanedione backbone. This compound exhibits notable properties such as being a potential chelating agent due to the presence of hydroxyl groups, which can form stable complexes with metal ions. It is typically used in various applications, including organic synthesis and as a potential intermediate in the production of dyes or pharmaceuticals. The presence of naphthyl groups contributes to its aromatic characteristics, which may influence its solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1,10-bis-(1-hydroxy-2-naphthyl)-1,10-decanedione is a versatile compound with potential applications in both industrial and research settings.
Formula:C30H30O4
InChI:InChI=1/C30H30O4/c31-27(25-19-17-21-11-7-9-13-23(21)29(25)33)15-5-3-1-2-4-6-16-28(32)26-20-18-22-12-8-10-14-24(22)30(26)34/h7-14,17-20,33-34H,1-6,15-16H2
SMILES:C(CCCCC(=O)c1ccc2ccccc2c1O)CCCC(=O)c1ccc2ccccc2c1O
Synonyms:- 1,10-Bis(1-Hydroxy-2-Naphthyl)Decane-1,10-Dione
- 1,10-Decanedione, 1,10-Bis(1-Hydroxy-2-Naphthalenyl)-
- 1,10-Bis(1-Hydroxynaphthalen-2-Yl)Decane-1,10-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.