CAS 133806-59-4: Purpactin A

Description:Purpactin A, with the CAS number 133806-59-4, is a natural product that belongs to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus Penicillium. This compound is characterized by its unique chemical structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Purpactin A has garnered interest in the field of medicinal chemistry due to its potential antimicrobial and antifungal properties. Its mechanism of action often involves the inhibition of specific enzymes or pathways in target organisms, making it a subject of research for developing new therapeutic agents. Additionally, the compound's stability and solubility in various solvents can influence its application in pharmaceutical formulations. As with many natural products, the extraction and purification processes are crucial for obtaining Purpactin A in sufficient quantities for further study and potential application in drug development.

Formula:C₂₃H₂₆O₇

InChI:InChI=1S/C23H26O7/c1-12(2)8-19(29-14(4)24)16-6-7-18-20(22(16)27-5)23(26)28-11-15-9-13(3)10-17(25)21(15)30-18/h6-7,9-10,12,19,25H,8,11H2,1-5H3/t19-/m0/s1

InChI key:InChIKey=NUYFKDBCHFKOBT-IBGZPJMESA-N

SMILES:O=C1OCC2=CC(=CC(O)=C2OC3=CC=C(C(OC)=C13)C(OC(=O)C)CC(C)C)C

Synonyms:
5H,7H-Dibenzo[b,g][1,5]dioxocin-5-one, 3-[1-(acetyloxy)-3-methylbutyl]-11-hydroxy-4-methoxy-9-methyl-, (S)-
FO 608A
Purpactin A
1-(11-hydroxy-4-methoxy-9-methyl-5-oxo-5H,7H-dibenzo[b,g][1,5]dioxocin-3-yl)-3-methylbutyl acetate
5H,7H-Dibenzo[b,g][1,5]dioxocin-5-one, 3-[(1S)-1-(acetyloxy)-3-methylbutyl]-11-hydroxy-4-methoxy-9-methyl-
5H,7H-Dibenzo(b,g)(1,5)dioxocin-5-one, 3-(1-(acetyloxy)-3-methylbutyl)-11-hydroxy-4-methoxy-9-methyl-
3-[(1S)-1-(Acetyloxy)-3-methylbutyl]-11-hydroxy-4-methoxy-9-methyl-5H,7H-dibenzo[b,g][1,5]dioxocin-5-one