CymitQuimica logo

CAS 1338083-27-4

:

4,4,5,5-Tetramethyl-2-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-thienyl]-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-thienyl]-1,3,2-dioxaborolane is a complex organic compound characterized by its unique structural features, including a dioxaborolane ring and a thienyl group. The presence of multiple methyl groups contributes to its steric bulk, while the tridecafluorohexyl substituent imparts significant hydrophobicity and chemical stability, making it resistant to degradation. This compound is likely to exhibit interesting electronic properties due to the conjugation between the thienyl moiety and the dioxaborolane, which may enhance its utility in organic electronics or as a building block in materials science. Additionally, the fluorinated alkyl chain can influence its solubility and interaction with other substances, potentially making it useful in applications such as coatings or surfactants. Overall, the combination of these features suggests that this compound could have specialized applications in fields such as organic synthesis, materials science, or pharmaceuticals.
Formula:C16H14BF13O2S
InChI:InChI=1S/C16H14BF13O2S/c1-9(2)10(3,4)32-17(31-9)8-6-5-7(33-8)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)30/h5-6H,1-4H3
InChI key:InChIKey=SCCANANFFIZWAW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2SC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)=CC2
Synonyms:
  • 4,4,5,5-Tetramethyl-2-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-thienyl]-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-thienyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.