CAS 1338096-89-1

1-Bromo-4-[(1Z)-2-nitro-1-propen-1-yl]benzene

Description:

1-Bromo-4-[(1Z)-2-nitro-1-propen-1-yl]benzene is an organic compound characterized by the presence of a bromine atom and a nitro-substituted propenyl group attached to a benzene ring. This compound features a bromobenzene structure, where the bromine atom is located at the para position relative to the propenyl group. The propenyl group contains a double bond and a nitro functional group, which contributes to its reactivity and polarity. The presence of the nitro group typically enhances the compound's electrophilic character, making it more reactive in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound's structure suggests potential applications in organic synthesis and materials science, particularly in the development of functionalized aromatic compounds. Its physical properties, such as solubility and boiling point, would be influenced by the bromine and nitro substituents, as well as the overall molecular structure. Safety and handling precautions should be observed due to the presence of the bromine and nitro groups, which can pose health and environmental risks.

Formula: C₉H₈BrNO₂

InChI: InChI=1S/C9H8BrNO2/c1-7(11(12)13)6-8-2-4-9(10)5-3-8/h2-6H,1H3/b7-6-

InChI key: InChIKey=YHCYQNXJXRRFFM-SREVYHEPSA-N

SMILES: C(=C(\N(=O)=O)/C)\C1=CC=C(Br)C=C1

Synonyms:

• 1-Bromo-4-[(1Z)-2-nitro-1-propen-1-yl]benzene
• Benzene, 1-bromo-4-[(1Z)-2-nitro-1-propen-1-yl]-