
CAS 1338219-66-1
:2,3-Dihydro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile
Description:
2,3-Dihydro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and a pyridine ring. This compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonitrile group often enhances the compound's ability to participate in nucleophilic reactions, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the bicyclic nature of the molecule may influence its biological activity, potentially offering properties such as antimicrobial or anticancer effects. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. Overall, 2,3-Dihydro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile represents a significant structure in the field of organic chemistry, with implications for further research and development.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c9-5-7-8-6(1-3-10-7)2-4-11-8/h1,3,11H,2,4H2
InChI key:InChIKey=TVYCCCRBYQBMDN-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(CCN2)=CC=N1
Synonyms:- 1H,2H,3H-Pyrrolo[2,3-c]pyridine-7-carbonitrile
- 2,3-Dihydro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile
- 1H-Pyrrolo[2,3-c]pyridine-7-carbonitrile, 2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.