CAS 1338222-31-3

3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3S)-

Description:

3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3S)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. The (3S)- designation refers to the specific stereochemistry of the piperidine moiety, which can influence the compound's interaction with biological targets, such as receptors or enzymes. This compound may exhibit properties relevant to medicinal chemistry, including potential use as a drug candidate or in research settings. Its molecular interactions, solubility, and stability are critical factors for its application in various fields, including pharmacology and organic synthesis. As with many compounds, safety and handling precautions are essential due to the presence of halogenated groups, which can affect toxicity and environmental impact.

Formula: C₁₂H₁₇BrN₂·2ClH

InChI: InChI=1S/C12H17BrN2.2ClH/c13-11-4-1-3-10(7-11)8-15-12-5-2-6-14-9-12;;/h1,3-4,7,12,14-15H,2,5-6,8-9H2;2*1H/t12-;;/m0../s1

InChI key: InChIKey=MFBVYIRHVJKRLN-LTCKWSDVSA-N

SMILES: C(N[C@H]1CCCNC1)C2=CC(Br)=CC=C2.Cl

Synonyms:

• 3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3S)-

(3S)-3-[(3-Bromobenzyl)amino]piperidine dihydrochloride

CAS: 1338222-31-3

(3S)-3-[(3-Bromobenzyl)amino]piperidine dihydrochloride

Purity: ≥95%

Molecular weight: 342.10g/mol

Ref: 54-OR62016

(S)-N-[(3-Bromophenyl)methyl]piperidin-3-amine dihydrochloride

CAS: 1338222-31-3

Formula: C₁₂H₁₉BrCl₂N₂

Molecular weight: 342.1

Ref: 10-F069541