CAS 1338222-33-5: 4-Morpholinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description: 4-Morpholinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a morpholine ring and a piperidine moiety. This compound typically exhibits properties associated with amides, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous environments, making it suitable for pharmaceutical applications. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often found in various therapeutic agents. Additionally, the stereochemistry denoted by (3R) implies that the compound has a specific three-dimensional arrangement, which can significantly affect its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes due to its structural characteristics and potential bioactivity.

Formula: C₁₀H₁₉N₃O₂·ClH

InChI: InChI=1S/C10H19N3O2.ClH/c14-10(13-4-6-15-7-5-13)12-9-2-1-3-11-8-9;/h9,11H,1-8H2,(H,12,14);1H/t9-;/m1./s1

InChI key: InChIKey=FGTLCCRTMPKZIK-SBSPUUFOSA-N

SMILES: Cl.O=C(NC1CNCCC1)N2CCOCC2

Synonyms:

• 4-Morpholinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-N-(Piperidin-3-yl)morpholine-4-carboxamide hydrochloride

CAS: 1338222-33-5

• Molecular weight: 249.74000549316406

(R)-N-(Piperidin-3-yl)morpholine-4-carboxamide hydrochloride

CAS: 1338222-33-5

Please enquire for more information about (R)-N-(Piperidin-3-yl)morpholine-4-carboxamide hydrochloride including the price, delivery time and more …

• Formula: C₁₀H₂₀ClN₃O₂
• Purity: Min. 95%
• Molecular weight: 249.74 g/mol