CAS 1338222-39-1

Urea, N,N-dimethyl-N′-(3S)-3-piperidinyl-, hydrochloride (1:1)

Description:

Urea, N,N-dimethyl-N′-(3S)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its urea functional group and a piperidine moiety. This substance is typically a white crystalline solid, soluble in water due to the presence of the hydrochloride salt, which enhances its solubility and stability. The piperidine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as being a potential ligand for various biological targets, and its structure suggests it could interact with neurotransmitter systems. As a hydrochloride salt, it is likely to have improved handling characteristics compared to its free base form, including better stability and ease of formulation in drug development. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structural features may provide avenues for further exploration in medicinal chemistry and related fields.

Formula: C₈H₁₇N₃O·ClH

InChI: InChI=1S/C8H17N3O.ClH/c1-11(2)8(12)10-7-4-3-5-9-6-7;/h7,9H,3-6H2,1-2H3,(H,10,12);1H/t7-;/m0./s1

InChI key: InChIKey=FOHHWQWGPZHBNS-FJXQXJEOSA-N

SMILES: N(C(N(C)C)=O)[C@H]1CCCNC1.Cl

Synonyms:

• Urea, N,N-dimethyl-N′-(3S)-3-piperidinyl-, hydrochloride (1:1)

1,1-Dimethyl-3-[(3S)-piperidin-3-yl]urea hydrochloride

CAS: 1338222-39-1

1,1-Dimethyl-3-[(3S)-piperidin-3-yl]urea hydrochloride

Purity: ≥95%

Molecular weight: 207.70g/mol

Ref: 54-OR62022

(S)-3,3-Dimethyl-1-(piperidin-3-yl)ureahydrochloride

CAS: 1338222-39-1

Formula: C₈H₁₈ClN₃O

Molecular weight: 207.7

Ref: 10-F069547