
CAS 1338222-41-5
:3-Pyridinecarboxamide, N-(3S)-3-piperidinyl-, hydrochloride (1:2)
Description:
3-Pyridinecarboxamide, N-(3S)-3-piperidinyl-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with amides, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous environments. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific stereochemistry, indicated by the (3S) designation, can also play a crucial role in its biological interactions and efficacy. Overall, this compound's unique structural characteristics and potential biological implications make it a subject of interest in various chemical and pharmaceutical research contexts.
Formula:C11H15N3O·2ClH
InChI:InChI=1S/C11H15N3O.2ClH/c15-11(9-3-1-5-12-7-9)14-10-4-2-6-13-8-10;;/h1,3,5,7,10,13H,2,4,6,8H2,(H,14,15);2*1H/t10-;;/m0../s1
InChI key:InChIKey=JVHFVOGSQHRSNR-XRIOVQLTSA-N
SMILES:C(N[C@H]1CCCNC1)(=O)C=2C=CC=NC2.Cl
Synonyms:- 3-Pyridinecarboxamide, N-(3S)-3-piperidinyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-[(3S)-(Piperidin-3-yl)]nicotinamide dihydrochloride
CAS:N-[(3S)-(Piperidin-3-yl)]nicotinamide dihydrochlorideMolecular weight:278.18g/mol(S)-N-(Piperidin-3-yl)pyridine-3-carboxamide dihydrochloride
CAS:Formula:C11H17Cl2N3OMolecular weight:278.18

